ChemNet > CAS > 5905-69-1 4-(difluoromethoxy)bromobenzene
5905-69-1 4-(difluoromethoxy)bromobenzene
| termék neve |
4-(difluoromethoxy)bromobenzene |
| Szinonimák |
1-Bromo-4-(difluoromethoxy)benzene; p-Difluoromethoxybromobenzene |
| MF |
C7H5BrF2O |
| Molekulatömeg |
223.0148 |
| InChI |
InChI=1/C7H5BrF2O/c8-5-1-3-6(4-2-5)11-7(9)10/h1-4,7H |
| CAS-szám |
5905-69-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.583g/cm3 |
| Forráspont |
205.406°C at 760 mmHg |
| Törésmutató |
1.492 |
| Gyulladáspont |
92.591°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
