ChemNet > CAS > 591-23-1 3-Methylcyclohexanol, mixture of cis and trans
591-23-1 3-Methylcyclohexanol, mixture of cis and trans
termék neve |
3-Methylcyclohexanol, mixture of cis and trans |
Szinonimák |
3-Methylcyclohexanol (cis+trans); 3-Methylcyclohexanol; (1S,3R)-3-methylcyclohexanol; (1R,3R)-3-methylcyclohexanol; (1S,3S)-3-methylcyclohexanol |
MF |
C7H14O |
Molekulatömeg |
114.1855 |
InChI |
InChI=1/C7H14O/c1-6-3-2-4-7(8)5-6/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
CAS-szám |
591-23-1 |
EINECS |
209-709-1 |
Molekuláris szerkezete |
|
Sűrűség |
0.925g/cm3 |
Olvadáspont |
-74℃ |
Forráspont |
170.3°C at 760 mmHg |
Törésmutató |
1.462 |
Gyulladáspont |
62.8°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|