ChemNet > CAS > 610-16-2 2-Dimethylaminobenzoic acid
610-16-2 2-Dimethylaminobenzoic acid
termék neve |
2-Dimethylaminobenzoic acid |
Szinonimák |
Benzoic acid, 2-(dimethylamino)-; 2-(Dimethylamino)benzoic acid; AI3-05925; N,N-Dimethylanthranilic acid; NSC 45790; Anthranilic acid, N,N-dimethyl- (8CI); 2-(dimethylamino)benzoate |
MF |
C9H10NO2 |
Molekulatömeg |
164.1817 |
InChI |
InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)/p-1 |
CAS-szám |
610-16-2 |
EINECS |
210-209-0 |
Molekuláris szerkezete |
|
Olvadáspont |
71-72℃ |
Forráspont |
288.5°C at 760 mmHg |
Gyulladáspont |
128.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|