ChemNet > CAS > 613-13-8 2-Aminoanthracene
613-13-8 2-Aminoanthracene
| termék neve |
2-Aminoanthracene |
| Szinonimák |
2-anthramine practical grade*crystalline; 2-anthrylamine
; 2-Anthramine; 2-Anthranamine; anthracen-2-amine |
| MF |
C14H11N |
| Molekulatömeg |
193.2438 |
| InChI |
InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| CAS-szám |
613-13-8 |
| EINECS |
210-330-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.208g/cm3 |
| Olvadáspont |
238-241℃ |
| Forráspont |
414.2°C at 760 mmHg |
| Törésmutató |
1.765 |
| Gyulladáspont |
229°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R33:Danger of cummulative effects.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
