ChemNet > CAS > 615-94-1 2,5-Dihydroxy-1,4-benzoquinone
615-94-1 2,5-Dihydroxy-1,4-benzoquinone
| termék neve |
2,5-Dihydroxy-1,4-benzoquinone |
| Szinonimák |
2,5-Dihydroxybenzoquinone; 2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
| MF |
C6H4O4 |
| Molekulatömeg |
140.0936 |
| InChI |
InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
| CAS-szám |
615-94-1 |
| EINECS |
210-454-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.843g/cm3 |
| Olvadáspont |
220℃ |
| Forráspont |
322.3°C at 760 mmHg |
| Törésmutató |
1.729 |
| Gyulladáspont |
162.9°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
|
|
