ChemNet > CAS > 636-93-1 2-methoxy-5-nitrophenol
636-93-1 2-methoxy-5-nitrophenol
| termék neve |
2-methoxy-5-nitrophenol |
| Szinonimák |
5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene); 3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol; 5-Nitroguaiacol |
| MF |
C7H7NO4 |
| Molekulatömeg |
169.1348 |
| InChI |
InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
| CAS-szám |
636-93-1 |
| EINECS |
211-269-0 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.367g/cm3 |
| Olvadáspont |
103-107℃ |
| Forráspont |
291°C at 760 mmHg |
| Törésmutató |
1.583 |
| Gyulladáspont |
147.1°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
