CAS No: 638-17-5, Chemical Name: 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
the physical and chemical property of 638-17-5, 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine is provided by ChemNet.com
ChemNet > CAS > 638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
| termék neve |
5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine |
| Szinonimák |
2,4,6-trimethyl-1,3,5-dithiazinane; 2,4,6-Trimethyl-1,3,5-dithiazine |
| MF |
C6H13NS2 |
| Molekulatömeg |
163.3041 |
| InChI |
InChI=1/C6H13NS2/c1-4-7-5(2)9-6(3)8-4/h4-7H,1-3H3 |
| CAS-szám |
638-17-5 |
| EINECS |
211-323-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.011g/cm3 |
| Forráspont |
260.7°C at 760 mmHg |
| Törésmutató |
1.501 |
| Gyulladáspont |
111.5°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
|
| Biztonsági Leírás |
|
|
