ChemNet > CAS > 68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
termék neve |
4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine |
Szinonimák |
6-(methoxymethyl)-2-(methylsulfanyl)pyrimidin-4(1H)-one |
MF |
C7H10N2O2S |
Molekulatömeg |
186.2315 |
InChI |
InChI=1/C7H10N2O2S/c1-11-4-5-3-6(10)9-7(8-5)12-2/h3H,4H2,1-2H3,(H,8,9,10) |
CAS-szám |
68087-13-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.3g/cm3 |
Forráspont |
286.6°C at 760 mmHg |
Törésmutató |
1.588 |
Gyulladáspont |
127.2°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|