ChemNet > CAS > 703-23-1 2-Hydroxy-6-methoxyacetophenone
703-23-1 2-Hydroxy-6-methoxyacetophenone
termék neve |
2-Hydroxy-6-methoxyacetophenone |
Szinonimák |
1-(2-Hydroxy-6-methoxyphenyl)ethan-1-one; 1-(2-hydroxy-6-methoxyphenyl)ethanone; 2'-Hydroxy-6'-methoxyacetophenone |
MF |
C9H10O3 |
Molekulatömeg |
166.1739 |
InChI |
InChI=1/C9H10O3/c1-6(10)9-7(11)4-3-5-8(9)12-2/h3-5,11H,1-2H3 |
CAS-szám |
703-23-1 |
EINECS |
211-872-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.158g/cm3 |
Olvadáspont |
58-60℃ |
Forráspont |
259.5°C at 760 mmHg |
Törésmutató |
1.537 |
Gyulladáspont |
108.1°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|