ChemNet > CAS > 7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
7152-40-1 5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile
| termék neve |
5-Amino-4-cyano-1-phenyl-3-pyrazoleacetonitrile |
| Szinonimák |
1H-pyrazole-3-acetonitrile, 5-amino-4-cyano-1-phenyl-; 1H-Pyrazole-4-carbonitrile, 5-amino-3-cyanomethyl-1-phenyl-; 5-Amino-3-cyanomethyl-1-phenyl-1H-pyrazole-4-carbonitrile |
| MF |
C12H9N5 |
| Molekulatömeg |
223.2334 |
| InChI |
InChI=1/C12H9N5/c13-7-6-11-10(8-14)12(15)17(16-11)9-4-2-1-3-5-9/h1-5H,6,15H2 |
| CAS-szám |
7152-40-1 |
| EINECS |
230-496-6 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.27g/cm3 |
| Olvadáspont |
165.5-166.5℃ |
| Forráspont |
486.8°C at 760 mmHg |
| Törésmutató |
1.673 |
| Gyulladáspont |
248.2°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
