ChemNet > CAS > 716-53-0 9-chloroanthracene
716-53-0 9-chloroanthracene
termék neve |
9-chloroanthracene |
Szinonimák |
Anthracene, 9-chloro-; 9-Chloroanthracene; CCRIS 5547 |
MF |
C14H9Cl |
Molekulatömeg |
212.6743 |
InChI |
InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
CAS-szám |
716-53-0 |
EINECS |
211-937-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.253g/cm3 |
Olvadáspont |
103-103℃ |
Forráspont |
370.1°C at 760 mmHg |
Törésmutató |
1.717 |
Gyulladáspont |
179.2°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|