CAS No: 74472-49-4, Chemical Name: 2,2',3,4,5,6,6'-heptachlorobiphenyl
the physical and chemical property of 74472-49-4, 2,2',3,4,5,6,6'-heptachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
74472-49-4 2,2',3,4,5,6,6'-heptachlorobiphenyl
termék neve |
2,2',3,4,5,6,6'-heptachlorobiphenyl |
Szinonimák |
1,1'-biphenyl, 2,2',3,4,5,6,6'-heptachloro-; 2,2',3,4,5,6,6'-Heptachloro-1,1'-biphenyl; 2,2',3,4,5,6,6'-PCB; 74472-49-4 |
MF |
C12H3Cl7 |
Molekulatömeg |
395.3232 |
InChI |
InChI=1/C12H3Cl7/c13-4-2-1-3-5(14)6(4)7-8(15)10(17)12(19)11(18)9(7)16/h1-3H |
CAS-szám |
74472-49-4 |
Molekuláris szerkezete |
|
Sűrűség |
1.658g/cm3 |
Forráspont |
395.2°C at 760 mmHg |
Törésmutató |
1.632 |
Gyulladáspont |
189.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
|
Biztonsági Leírás |
|
|