ChemNet > CAS > 74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
74772-17-1 3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid
| termék neve |
3-(1H-pyrrol-1-yl)thiophene-2-carboxylic acid |
| MF |
C9H7NO2S |
| Molekulatömeg |
193.2224 |
| InChI |
InChI=1/C9H7NO2S/c11-9(12)8-7(3-6-13-8)10-4-1-2-5-10/h1-6H,(H,11,12) |
| CAS-szám |
74772-17-1 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.37g/cm3 |
| Olvadáspont |
174℃ |
| Forráspont |
377.3°C at 760 mmHg |
| Törésmutató |
1.669 |
| Gyulladáspont |
182°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
