ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| termék neve |
Bromodichloromethane |
| Szinonimák |
FC-20B1 |
| MF |
CHBrCl2 |
| Molekulatömeg |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS-szám |
75-27-4 |
| EINECS |
200-856-7 |
| Molekuláris szerkezete |
|
| Sűrűség |
2.013g/cm3 |
| Olvadáspont |
-55℃ |
| Forráspont |
89.7°C at 760 mmHg |
| Törésmutató |
1.503 |
| Gyulladáspont |
1.3°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
