ChemNet > CAS > 7581-97-7 2,3-Dichlorobutane
7581-97-7 2,3-Dichlorobutane
| termék neve |
2,3-Dichlorobutane |
| Szinonimák |
2,3-Dichlorobutane,mixture of dl and meso; 2,3-Dichlorobutane- dl + meso; (2S,3S)-2,3-dichlorobutane |
| MF |
C4H8Cl2 |
| Molekulatömeg |
127.0123 |
| InChI |
InChI=1/C4H8Cl2/c1-3(5)4(2)6/h3-4H,1-2H3/t3-,4-/m0/s1 |
| CAS-szám |
7581-97-7 |
| EINECS |
231-486-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.076g/cm3 |
| Olvadáspont |
-80℃ |
| Forráspont |
110.467°C at 760 mmHg |
| Törésmutató |
1.425 |
| Gyulladáspont |
18.333°C |
| Veszély szimbólumok |
 F:Highly flammable;
|
| Kockázatot kódok |
R11:Highly flammable.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
|
|
