ChemNet > CAS > 766-39-2 2,3-Dimethylmaleic anhydride
766-39-2 2,3-Dimethylmaleic anhydride
| termék neve |
2,3-Dimethylmaleic anhydride |
| Szinonimák |
3,4-Dimethyl-2,5-furandione; 3,4-dimethylfuran-2,5-dione; 4,5-Dimethyl-1,3-Dioxa-2-Oxo-Cyclopentene |
| MF |
C6H6O3 |
| Molekulatömeg |
126.11 |
| InChI |
InChI=1/C6H6O3/c1-3-4(2)6(8)9-5(3)7/h1-2H3 |
| CAS-szám |
766-39-2 |
| EINECS |
212-165-8 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.236g/cm3 |
| Olvadáspont |
93-96℃ |
| Forráspont |
223°C at 760 mmHg |
| Törésmutató |
1.486 |
| Gyulladáspont |
95.6°C |
| Veszély szimbólumok |
 Xn:Harmful;
|
| Kockázatot kódok |
R22:;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
