ChemNet > CAS > 771-62-0 pentafluorothiophenol
771-62-0 pentafluorothiophenol
| termék neve |
pentafluorothiophenol |
| Szinonimák |
Pentafluorobenzenethiol |
| MF |
C6HF5S |
| Molekulatömeg |
200.12 |
| InChI |
InChI=1/C6HF5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H |
| CAS-szám |
771-62-0 |
| EINECS |
212-236-3 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.5 |
| Olvadáspont |
-24℃ |
| Forráspont |
143℃ |
| Törésmutató |
1.463-1.465 |
| Gyulladáspont |
51℃ |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R10:Flammable.;
R34:Causes burns.;
|
| Biztonsági Leírás |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
