ChemNet > CAS > 827-15-6 iodopentafluorobenzene
827-15-6 iodopentafluorobenzene
| termék neve |
iodopentafluorobenzene |
| Szinonimák |
Pentafluoroiodobenzene; 1,2,3,4,5-pentafluoro-6-iodo-benzene |
| MF |
C6F5I |
| Molekulatömeg |
293.9607 |
| InChI |
InChI=1/C6F5I/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| CAS-szám |
827-15-6 |
| EINECS |
212-565-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
2.217g/cm3 |
| Forráspont |
166.7°C at 760 mmHg |
| Törésmutató |
1.502 |
| Gyulladáspont |
61.3°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
