ChemNet > CAS > 90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
90-24-4 2-Hydroxy-4,6-dimethoxyacetophenone
termék neve |
2-Hydroxy-4,6-dimethoxyacetophenone |
Szinonimák |
xanthoxylin |
MF |
C10H12O4 |
Molekulatömeg |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6(11)10-8(12)4-7(13-2)5-9(10)14-3/h4-5,12H,1-3H3 |
CAS-szám |
90-24-4 |
EINECS |
201-978-3 |
Molekuláris szerkezete |
|
Sűrűség |
1.172g/cm3 |
Olvadáspont |
80-82℃ |
Forráspont |
355.1°C at 760 mmHg |
Törésmutató |
1.527 |
Gyulladáspont |
141.2°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|