ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
termék neve |
2,3-Benzanthracene |
Szinonimák |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
MF |
C18H12 |
Molekulatömeg |
228.2879 |
InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
CAS-szám |
92-24-0 |
EINECS |
202-138-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.19g/cm3 |
Olvadáspont |
300℃ |
Forráspont |
436.7°C at 760 mmHg |
Törésmutató |
1.771 |
Gyulladáspont |
209.1°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R40:Possible risks of irreversible effects.;
|
Biztonsági Leírás |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|