ChemNet > CAS > 934-00-9 3-Methoxycatechol
934-00-9 3-Methoxycatechol
| termék neve |
3-Methoxycatechol |
| Szinonimák |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| MF |
C7H8O3 |
| Molekulatömeg |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| CAS-szám |
934-00-9 |
| EINECS |
213-276-4 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.27g/cm3 |
| Olvadáspont |
39-43℃ |
| Forráspont |
268.1°C at 760 mmHg |
| Törésmutató |
1.579 |
| Gyulladáspont |
119.5°C |
| Veszély szimbólumok |
 Xi:Irritant;
|
| Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|
