ChemNet > CAS > 96784-54-2 3-Methyl-4-nitrobenzonitrile
96784-54-2 3-Methyl-4-nitrobenzonitrile
| termék neve |
3-Methyl-4-nitrobenzonitrile |
| Szinonimák |
4-Nitro-m-tolunitrile;
|
| MF |
C8H6N2O2 |
| Molekulatömeg |
162.1454 |
| InChI |
InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
| CAS-szám |
96784-54-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.26g/cm3 |
| Olvadáspont |
82-83℃ |
| Forráspont |
322.2°C at 760 mmHg |
| Törésmutató |
1.568 |
| Gyulladáspont |
148.6°C |
| Veszély szimbólumok |
|
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
