ChemNet > CAS > 96994-73-9 2-dimethylamino-6-fluorobenzonitrile
96994-73-9 2-dimethylamino-6-fluorobenzonitrile
termék neve |
2-dimethylamino-6-fluorobenzonitrile |
MF |
C9H9FN2 |
Molekulatömeg |
164.1796 |
InChI |
InChI=1/C9H9FN2/c1-12(2)9-5-3-4-8(10)7(9)6-11/h3-5H,1-2H3 |
CAS-szám |
96994-73-9 |
Molekuláris szerkezete |
|
Sűrűség |
1.13g/cm3 |
Forráspont |
267.4°C at 760 mmHg |
Törésmutató |
1.53 |
Gyulladáspont |
115.5°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|