ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
termék neve |
2-(Difluoromethoxy)benzoic acid |
Szinonimák |
2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
MF |
C8H6F2O3 |
Molekulatömeg |
188.1282 |
InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
CAS-szám |
97914-59-5 |
Molekuláris szerkezete |
|
Sűrűség |
1.37g/cm3 |
Forráspont |
273.6°C at 760 mmHg |
Törésmutató |
1.496 |
Gyulladáspont |
119.3°C |
Veszély szimbólumok |
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|