ChemNet > CAS > 103956-09-8 3,4-Diaminobenzhydrazide
103956-09-8 3,4-Diaminobenzhydrazide
Nama produk |
3,4-Diaminobenzhydrazide |
Sinonim |
3,4-diaminobenzohydrazide |
MF |
C7H10N4O |
Berat Molekul |
166.1805 |
InChI |
InChI=1/C7H10N4O/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,8-10H2,(H,11,12) |
CAS NO |
103956-09-8 |
Struktur Molekul |
|
Kepadatan |
1.367g/cm3 |
Indeks bias |
1.705 |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|