ChemNet > CAS > 111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
Nama produk |
(2-methyl-5-phenyl-3-furyl)methanol |
Sinonim |
(2-methyl-5-phenylfuran-3-yl)methanol |
MF |
C12H12O2 |
Berat Molekul |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
CAS NO |
111787-91-8 |
Struktur Molekul |
|
Kepadatan |
1.123g/cm3 |
Titik lebur |
22℃ |
Titik didih |
233.9°C at 760 mmHg |
Indeks bias |
1.562 |
Titik nyala |
95.2°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|