ChemNet > CAS > 116668-47-4 6-Amino-2-naphthoic acid
116668-47-4 6-Amino-2-naphthoic acid
Nama produk |
6-Amino-2-naphthoic acid |
MF |
C11H8NO2 |
Berat Molekul |
186.1873 |
InChI |
InChI=1/C11H9NO2/c12-10-4-3-7-5-9(11(13)14)2-1-8(7)6-10/h1-6H,12H2,(H,13,14)/p-1 |
CAS NO |
116668-47-4 |
Struktur Molekul |
|
Titik lebur |
222-227℃ |
Titik didih |
416.7°C at 760 mmHg |
Titik nyala |
205.8°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|