ChemNet > CAS > 13194-73-5 3,5-Dibromo-4-methylaniline
13194-73-5 3,5-Dibromo-4-methylaniline
Nama produk |
3,5-Dibromo-4-methylaniline |
Sinonim |
3,5-Dibromo-p-toluidine |
MF |
C7H7Br2N |
Berat Molekul |
264.9452 |
InChI |
InChI=1/C7H7Br2N/c1-4-6(8)2-5(10)3-7(4)9/h2-3H,10H2,1H3 |
CAS NO |
13194-73-5 |
Struktur Molekul |
|
Kepadatan |
1.887g/cm3 |
Titik didih |
308.8°C at 760 mmHg |
Indeks bias |
1.641 |
Titik nyala |
140.6°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|