ChemNet > CAS > 136-64-1 Terephthalic dihydrazide
136-64-1 Terephthalic dihydrazide
Nama produk |
Terephthalic dihydrazide |
Sinonim |
Benzene-1,4-dicarboxylic acid dihydrazide; benzene-1,4-dicarbohydrazide |
MF |
C8H10N4O2 |
Berat Molekul |
194.1906 |
InChI |
InChI=1/C8H10N4O2/c9-11-7(13)5-1-2-6(4-3-5)8(14)12-10/h1-4H,9-10H2,(H,11,13)(H,12,14) |
CAS NO |
136-64-1 |
EINECS |
205-253-2 |
Struktur Molekul |
|
Kepadatan |
1.344g/cm3 |
Indeks bias |
1.628 |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|