ChemNet > CAS > 147123-47-5 3-Aminothiophene-2-carboxamide
147123-47-5 3-Aminothiophene-2-carboxamide
Nama produk |
3-Aminothiophene-2-carboxamide |
MF |
C5H6N2OS |
Berat Molekul |
142.1789 |
InChI |
InChI=1/C5H6N2OS/c6-3-1-2-9-4(3)5(7)8/h1-2H,6H2,(H2,7,8) |
CAS NO |
147123-47-5 |
Struktur Molekul |
|
Kepadatan |
1.423g/cm3 |
Titik lebur |
120℃ |
Titik didih |
368.7°C at 760 mmHg |
Indeks bias |
1.681 |
Titik nyala |
176.8°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|