ChemNet > CAS > 147834-57-9 1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethan-1-one
147834-57-9 1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethan-1-one
Nama produk |
1-(2,3,4,5,6-pentamethylphenyl)-2-phenylethan-1-one |
Sinonim |
1-(pentamethylphenyl)-2-phenylethanone |
MF |
C19H22O |
Berat Molekul |
266.3774 |
InChI |
InChI=1/C19H22O/c1-12-13(2)15(4)19(16(5)14(12)3)18(20)11-17-9-7-6-8-10-17/h6-10H,11H2,1-5H3 |
CAS NO |
147834-57-9 |
Struktur Molekul |
|
Kepadatan |
1.012g/cm3 |
Titik lebur |
135℃ |
Titik didih |
423.1°C at 760 mmHg |
Indeks bias |
1.558 |
Titik nyala |
184.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|