ChemNet > CAS > 15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
15816-71-4 octanoic acid, compound with dicyclohexylamine (1:1)
Nama produk |
octanoic acid, compound with dicyclohexylamine (1:1) |
Sinonim |
Octanoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine caprylate; N-cyclohexylcyclohexanaminium octanoate |
MF |
C20H39NO2 |
Berat Molekul |
325.5292 |
InChI |
InChI=1/C12H23N.C8H16O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8(9)10/h11-13H,1-10H2;2-7H2,1H3,(H,9,10) |
CAS NO |
15816-71-4 |
EINECS |
239-914-1 |
Struktur Molekul |
|
Titik didih |
466.8°C at 760 mmHg |
Titik nyala |
236.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
|
|