ChemNet > CAS > 15822-77-2 1-(2-nitrophenyl)piperidine
15822-77-2 1-(2-nitrophenyl)piperidine
Nama produk |
1-(2-nitrophenyl)piperidine |
Sinonim |
1-(2-Nitrophenyl)piperidine; 1-(O-Nitrophenyl)piperidine; Piperidine, 1-(2-nitrophenyl)- |
MF |
C11H14N2O2 |
Berat Molekul |
206.2411 |
InChI |
InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
CAS NO |
15822-77-2 |
Struktur Molekul |
|
Kepadatan |
1.188g/cm3 |
Titik lebur |
77℃ |
Titik didih |
337.7°C at 760 mmHg |
Indeks bias |
1.578 |
Titik nyala |
158°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|