ChemNet > CAS > 1595-05-7 4-n-Butyltoluene
1595-05-7 4-n-Butyltoluene
Nama produk |
4-n-Butyltoluene |
Sinonim |
Benzene, 1-butyl-4-methyl-; p-Butyltoluene; p-Butyltoluene [UN2667] [Keep away from food]; 1-butyl-4-methylbenzene |
MF |
C11H16 |
Berat Molekul |
148.2447 |
InChI |
InChI=1/C11H16/c1-3-4-5-11-8-6-10(2)7-9-11/h6-9H,3-5H2,1-2H3 |
CAS NO |
1595-05-7 |
Struktur Molekul |
|
Kepadatan |
0.864g/cm3 |
Titik didih |
205.6°C at 760 mmHg |
Indeks bias |
1.493 |
Titik nyala |
71.1°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|