ChemNet > CAS > 16687-61-9 5-(4-Chlorophenyl)-1H-tetrazole
16687-61-9 5-(4-Chlorophenyl)-1H-tetrazole
Nama produk |
5-(4-Chlorophenyl)-1H-tetrazole |
Sinonim |
5-(4-chlorophenyl)-2H-tetrazole |
MF |
C7H5ClN4 |
Berat Molekul |
180.5944 |
InChI |
InChI=1/C7H5ClN4/c8-6-3-1-5(2-4-6)7-9-11-12-10-7/h1-4H,(H,9,10,11,12) |
CAS NO |
16687-61-9 |
Struktur Molekul |
|
Kepadatan |
1.448g/cm3 |
Titik didih |
356.2°C at 760 mmHg |
Indeks bias |
1.631 |
Titik nyala |
200.4°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|