ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
Nama produk |
2,3-Dichlorothiophene |
Sinonim |
2,3-dichloro-thiophene |
MF |
C4H2Cl2S |
Berat Molekul |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS NO |
17249-79-5;17249-29-5 |
Struktur Molekul |
|
Kepadatan |
1.488g/cm3 |
Titik lebur |
-26℃ |
Titik didih |
170.7°C at 760 mmHg |
Indeks bias |
1.584 |
Titik nyala |
68.9°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|