ChemNet > CAS > 175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
Nama produk |
1,4-dimethylpiperazine-2-carbohydrazide |
MF |
C7H16N4O |
Berat Molekul |
172.2281 |
InChI |
InChI=1/C7H16N4O/c1-10-3-4-11(2)6(5-10)7(12)9-8/h6H,3-5,8H2,1-2H3,(H,9,12) |
CAS NO |
175203-52-8 |
Struktur Molekul |
|
Kepadatan |
1.105g/cm3 |
Titik lebur |
105℃ |
Titik didih |
339.7°C at 760 mmHg |
Indeks bias |
1.511 |
Titik nyala |
159.2°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|