ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
Nama produk |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
Sinonim |
3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
MF |
C8H11ClO |
Berat Molekul |
158.6253 |
InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
CAS NO |
17530-69-7 |
Struktur Molekul |
|
Kepadatan |
1.09g/cm3 |
Titik didih |
217.7°C at 760 mmHg |
Indeks bias |
1.488 |
Titik nyala |
104.8°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|