ChemNet > CAS > 178374-78-2 3,5-difluoro-4-hydroxypropiophenone
178374-78-2 3,5-difluoro-4-hydroxypropiophenone
Nama produk |
3,5-difluoro-4-hydroxypropiophenone |
Sinonim |
3',5'-difluoro-4'-hydroxypropiophenone; 1-(3,5-difluoro-4-hydroxyphenyl)propan-1-one |
MF |
C9H8F2O2 |
Berat Molekul |
186.1554 |
InChI |
InChI=1/C9H8F2O2/c1-2-8(12)5-3-6(10)9(13)7(11)4-5/h3-4,13H,2H2,1H3 |
CAS NO |
178374-78-2 |
Struktur Molekul |
|
Kepadatan |
1.289g/cm3 |
Titik lebur |
126-128℃ |
Titik didih |
271.2°C at 760 mmHg |
Indeks bias |
1.504 |
Titik nyala |
117.8°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|