ChemNet > CAS > 18355-80-1 2,3-difluoroacetophenone
18355-80-1 2,3-difluoroacetophenone
Nama produk |
2,3-difluoroacetophenone |
Sinonim |
2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
MF |
C8H6F2O |
Berat Molekul |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
CAS NO |
18355-80-1 |
Struktur Molekul |
|
Kepadatan |
1.206g/cm3 |
Titik didih |
193.4°C at 760 mmHg |
Indeks bias |
1.472 |
Titik nyala |
71.5°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|