ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
Nama produk |
2-Bromo-5-iodotoluene |
Sinonim |
1-bromo-4-iodo-2-methylbenzene |
MF |
C7H6BrI |
Berat Molekul |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
CAS NO |
202865-85-8 |
Struktur Molekul |
|
Kepadatan |
2.062g/cm3 |
Titik didih |
264.2°C at 760 mmHg |
Indeks bias |
1.636 |
Titik nyala |
113.6°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|