ChemNet > CAS > 21298-53-3 3-(2-Thienyl)pyridine
21298-53-3 3-(2-Thienyl)pyridine
Nama produk |
3-(2-Thienyl)pyridine |
Sinonim |
2-(3-Pyridyl)thiophene; 3-(thiophen-2-yl)pyridine |
MF |
C9H7NS |
Berat Molekul |
161.2236 |
InChI |
InChI=1/C9H7NS/c1-3-8(7-10-5-1)9-4-2-6-11-9/h1-7H |
CAS NO |
21298-53-3 |
Struktur Molekul |
|
Kepadatan |
1.173g/cm3 |
Titik didih |
278.6°C at 760 mmHg |
Indeks bias |
1.604 |
Titik nyala |
121.8°C |
Simbol bahaya |
|
Kode Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|