ChemNet > CAS > 216393-67-8 4-Chloro-2-fluoro-6-iodoaniline
216393-67-8 4-Chloro-2-fluoro-6-iodoaniline
Nama produk |
4-Chloro-2-fluoro-6-iodoaniline |
MF |
C6H4ClFIN |
Berat Molekul |
271.4585 |
InChI |
InChI=1/C6H4ClFIN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
CAS NO |
216393-67-8 |
Struktur Molekul |
|
Kepadatan |
2.089g/cm3 |
Titik didih |
267.4°C at 760 mmHg |
Indeks bias |
1.665 |
Titik nyala |
115.5°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|