ChemNet > CAS > 2270-59-9 5-Bromo-2-methyl-2-pentene
2270-59-9 5-Bromo-2-methyl-2-pentene
Nama produk |
5-Bromo-2-methyl-2-pentene |
Sinonim |
5-bromo-2-methylpent-2-ene |
MF |
C6H11Br |
Berat Molekul |
163.0555 |
InChI |
InChI=1/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
CAS NO |
2270-59-9 |
Struktur Molekul |
|
Kepadatan |
1.215g/cm3 |
Titik didih |
152.6°C at 760 mmHg |
Indeks bias |
1.47 |
Titik nyala |
22.8°C |
Simbol bahaya |
|
Kode Risiko |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|