ChemNet > CAS > 2338-71-8 5-fluoroindole-3-carboxaldehyde
2338-71-8 5-fluoroindole-3-carboxaldehyde
Nama produk |
5-fluoroindole-3-carboxaldehyde |
Sinonim |
5-Fluoro-3-formylindole; 5-fluoro-1H-indole-3-carbaldehyde |
MF |
C9H6FNO |
Berat Molekul |
163.1484 |
InChI |
InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
CAS NO |
2338-71-8 |
Struktur Molekul |
|
Kepadatan |
1.385g/cm3 |
Titik didih |
342.4°C at 760 mmHg |
Indeks bias |
1.695 |
Titik nyala |
160.9°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|