ChemNet > CAS > 235088-69-4 3,4,5-trifluorobenzylamine
235088-69-4 3,4,5-trifluorobenzylamine
Nama produk |
3,4,5-trifluorobenzylamine |
Sinonim |
3,4,5-Trifluorobenzyl amine; 1-(3,4,5-trifluorophenyl)methanamine |
MF |
C7H6F3N |
Berat Molekul |
161.1244 |
InChI |
InChI=1/C7H6F3N/c8-5-1-4(3-11)2-6(9)7(5)10/h1-2H,3,11H2 |
CAS NO |
235088-69-4 |
Struktur Molekul |
|
Kepadatan |
1.32g/cm3 |
Titik didih |
176.3°C at 760 mmHg |
Indeks bias |
1.48 |
Titik nyala |
69.4°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|