ChemNet > CAS > 2567-29-5 Bromoethylbiphenyl
2567-29-5 Bromoethylbiphenyl
Nama produk |
Bromoethylbiphenyl |
Sinonim |
4-Bromoethylbiphenyl; 4-(Bromomethyl)biphenyl; 4-Phenylbenzyl bromide |
MF |
C13H11Br |
Berat Molekul |
247.1304 |
InChI |
InChI=1/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2 |
CAS NO |
2567-29-5 |
Struktur Molekul |
|
Kepadatan |
1.341g/cm3 |
Titik lebur |
86℃ |
Titik didih |
333.4°C at 760 mmHg |
Indeks bias |
1.605 |
Titik nyala |
161.3°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|