ChemNet > CAS > 287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
287917-96-8 4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde
Nama produk |
4-bromo-1-methyl-1H-pyrazole-3-carbaldehyde |
MF |
C5H5BrN2O |
Berat Molekul |
189.01 |
InChI |
InChI=1/C5H5BrN2O/c1-8-5(3-9)4(6)2-7-8/h2-3H,1H3 |
CAS NO |
287917-96-8 |
Struktur Molekul |
|
Kepadatan |
1.73g/cm3 |
Titik lebur |
68℃ |
Titik didih |
275.2°C at 760 mmHg |
Indeks bias |
1.621 |
Titik nyala |
120.2°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|