ChemNet > CAS > 30711-41-2 2-Octanoylthiophene
30711-41-2 2-Octanoylthiophene
Nama produk |
2-Octanoylthiophene |
Sinonim |
n-Heptyl 2-thienyl ketone; 1-(thiophen-2-yl)octan-1-one |
MF |
C12H18OS |
Berat Molekul |
210.3357 |
InChI |
InChI=1/C12H18OS/c1-2-3-4-5-6-8-11(13)12-9-7-10-14-12/h7,9-10H,2-6,8H2,1H3 |
CAS NO |
30711-41-2 |
Struktur Molekul |
|
Kepadatan |
1.004g/cm3 |
Titik didih |
312°C at 760 mmHg |
Indeks bias |
1.508 |
Titik nyala |
142.5°C |
Simbol bahaya |
|
Kode Risiko |
|
Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|