ChemNet > CAS > 30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
30742-59-7 5-nitro-2-pyrrolidin-1-yl-benzaldehyde
Nama produk |
5-nitro-2-pyrrolidin-1-yl-benzaldehyde |
MF |
C11H12N2O3 |
Berat Molekul |
220.2246 |
InChI |
InChI=1/C11H12N2O3/c14-8-9-7-10(13(15)16)3-4-11(9)12-5-1-2-6-12/h3-4,7-8H,1-2,5-6H2 |
CAS NO |
30742-59-7 |
Struktur Molekul |
|
Kepadatan |
1.314g/cm3 |
Titik lebur |
136℃ |
Titik didih |
402.1°C at 760 mmHg |
Indeks bias |
1.632 |
Titik nyala |
197°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|